Products 1421604-21-8
CAS 1421604-21-8 is the registry number for 4-(Carbamimidoylmethoxy)-N-cyclopentylbenzamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2-amino-2-iminoethoxy)-N-cyclopentylbenzamide;hydrochloride (CAS 1421604-21-8) is a chemical compound with the molecular formula C14H20ClN3O2 and a molecular weight of 297.78 g/mol. IUPAC name: 4-(2-amino-2-iminoethoxy)-N-cyclopentylbenzamide;hydrochloride. InChIKey: GXZYISLJEQLLAR-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3O2 |
|---|---|
| Molecular weight | 297.78 g/mol |
| IUPAC name | 4-(2-amino-2-iminoethoxy)-N-cyclopentylbenzamide;hydrochloride |
| InChIKey | GXZYISLJEQLLAR-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=CC=C(C=C2)OCC(=N)N.Cl |
Computed by PubChem (NCBI)