CAS 1421605-11-9 is the registry number for Pentafluorophenyl 5-bromo-4-methyl-1,3-thiazole-2-sulfonate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,3,4,5,6-pentafluorophenyl) 5-bromo-4-methyl-1,3-thiazole-2-sulfonate (CAS 1421605-11-9) is a chemical compound with the molecular formula C10H3BrF5NO3S2 and a molecular weight of 424.2 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 5-bromo-4-methyl-1,3-thiazole-2-sulfonate. InChIKey: YKPCWBNDEFDKDJ-UHFFFAOYSA-N.
| Molecular formula | C10H3BrF5NO3S2 |
|---|---|
| Molecular weight | 424.2 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 5-bromo-4-methyl-1,3-thiazole-2-sulfonate |
| InChIKey | YKPCWBNDEFDKDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)S(=O)(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)Br |
Computed by PubChem (NCBI)