CAS 1421677-31-7 appears in our catalog under these names: N,N'-bis(3-(4-Cyanophenoxy)-4-methylphenyl)urea, SC-60. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, Get quote.
1,3-bis[3-(4-cyanophenoxy)-4-methylphenyl]urea (CAS 1421677-31-7) is a chemical compound with the molecular formula C29H22N4O3 and a molecular weight of 474.5 g/mol. IUPAC name: 1,3-bis[3-(4-cyanophenoxy)-4-methylphenyl]urea. InChIKey: JDCSGVZYPMLYQO-UHFFFAOYSA-N.
| Molecular formula | C29H22N4O3 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | 1,3-bis[3-(4-cyanophenoxy)-4-methylphenyl]urea |
| InChIKey | JDCSGVZYPMLYQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)NC2=CC(=C(C=C2)C)OC3=CC=C(C=C3)C#N)OC4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)