CAS 1421758-33-9 is the registry number for 2,3-di-O-benzoyl-4-O-benzyl-alpha-l-rhamnopyranose, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5S,6S)-3-benzoyloxy-2-hydroxy-6-methyl-5-phenylmethoxyoxan-4-yl] benzoate (CAS 1421758-33-9) is a chemical compound with the molecular formula C27H26O7 and a molecular weight of 462.5 g/mol. IUPAC name: [(2R,3R,4R,5S,6S)-3-benzoyloxy-2-hydroxy-6-methyl-5-phenylmethoxyoxan-4-yl] benzoate. InChIKey: JGHKIYCOVKQHNU-CWDIBNIISA-N.
| Molecular formula | C27H26O7 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | [(2R,3R,4R,5S,6S)-3-benzoyloxy-2-hydroxy-6-methyl-5-phenylmethoxyoxan-4-yl] benzoate |
| InChIKey | JGHKIYCOVKQHNU-CWDIBNIISA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)