CAS 1421789-57-2 appears in our catalog under these names: 3,3-Bis(triethylsilyl)acrylaldehyde, 98%, 3,3-Bis(triethylsilyl)acrylaldehyde, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 500mg.
3,3-bis(triethylsilyl)prop-2-enal (CAS 1421789-57-2) is a chemical compound with the molecular formula C15H32OSi2 and a molecular weight of 284.58 g/mol. IUPAC name: 3,3-bis(triethylsilyl)prop-2-enal. InChIKey: IWOSTSGOKMWCBQ-UHFFFAOYSA-N.
| Molecular formula | C15H32OSi2 |
|---|---|
| Molecular weight | 284.58 g/mol |
| IUPAC name | 3,3-bis(triethylsilyl)prop-2-enal |
| InChIKey | IWOSTSGOKMWCBQ-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)C(=CC=O)[Si](CC)(CC)CC |
Computed by PubChem (NCBI)