Products 1421958-41-9
CAS 1421958-41-9 is the registry number for GSK 2636771. Offered by: Biosynth. Available pack sizes: 10mg, 50mg.
2-methyl-1-[[3-methyl-4-(trifluoromethyl)phenyl]methyl]-6-morpholin-4-ylbenzimidazole-4-carboxylic acid (CAS 1421958-41-9) is a chemical compound with the molecular formula C22H22F3N3O3 and a molecular weight of 433.4 g/mol. IUPAC name: 2-methyl-1-[[3-methyl-4-(trifluoromethyl)phenyl]methyl]-6-morpholin-4-ylbenzimidazole-4-carboxylic acid. InChIKey: BVGFNTQGDDTOER-UHFFFAOYSA-N.
| Molecular formula | C22H22F3N3O3 |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | 2-methyl-1-[[3-methyl-4-(trifluoromethyl)phenyl]methyl]-6-morpholin-4-ylbenzimidazole-4-carboxylic acid |
| InChIKey | BVGFNTQGDDTOER-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CN2C(=NC3=C(C=C(C=C32)N4CCOCC4)C(=O)O)C)C(F)(F)F |
Computed by PubChem (NCBI)