Products 1781880-44-1
CAS 1781880-44-1 appears in our catalog under these names: PHP 501 trifluoroacetate, GABAA receptor agent 2 (TFA). Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, Get quote.
4-[1-hydroxy-5-(3-phenylphenyl)pyrazol-4-yl]piperidine;2,2,2-trifluoroacetic acid (CAS 1781880-44-1) is a chemical compound with the molecular formula C22H22F3N3O3 and a molecular weight of 433.4 g/mol. IUPAC name: 4-[1-hydroxy-5-(3-phenylphenyl)pyrazol-4-yl]piperidine;2,2,2-trifluoroacetic acid. InChIKey: SULXXKLCQRXMHP-UHFFFAOYSA-N.
| Molecular formula | C22H22F3N3O3 |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | 4-[1-hydroxy-5-(3-phenylphenyl)pyrazol-4-yl]piperidine;2,2,2-trifluoroacetic acid |
| InChIKey | SULXXKLCQRXMHP-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=C(N(N=C2)O)C3=CC=CC(=C3)C4=CC=CC=C4.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)