CAS 1422-36-2 appears in our catalog under these names: 5,5,5-Trifluoro-4-(trifluoromethyl)pent-3-en-2-one, 95%, 5,5,5–TRIFLUORO–4–(TRIFLUOROMETHYL)PENT–3–EN–2–ONE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
5,5,5-trifluoro-4-(trifluoromethyl)pent-3-en-2-one (CAS 1422-36-2) is a chemical compound with the molecular formula C6H4F6O and a molecular weight of 206.09 g/mol. IUPAC name: 5,5,5-trifluoro-4-(trifluoromethyl)pent-3-en-2-one. InChIKey: NXASNTUMEFAWRZ-UHFFFAOYSA-N.
| Molecular formula | C6H4F6O |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | 5,5,5-trifluoro-4-(trifluoromethyl)pent-3-en-2-one |
| InChIKey | NXASNTUMEFAWRZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C=C(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)