CAS 1422007-52-0 appears in our catalog under these names: Methyl 3-fluoro-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate, 95%, Methyl 3–fluoro–4,6–dihydrothieno(3,4–b)thiophene–2–carboxylate, 3-Fluoro-4,6-dihydro-thieno[3,4-b]thiophene-2-carboxylic acid methyl ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-fluoro-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate (CAS 1422007-52-0) is a chemical compound with the molecular formula C8H7FO2S2 and a molecular weight of 218.3 g/mol. IUPAC name: methyl 3-fluoro-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate. InChIKey: AXNDIFNUJBHZCZ-UHFFFAOYSA-N.
| Molecular formula | C8H7FO2S2 |
|---|---|
| Molecular weight | 218.3 g/mol |
| IUPAC name | methyl 3-fluoro-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate |
| InChIKey | AXNDIFNUJBHZCZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)CSC2)F |
Computed by PubChem (NCBI)