CAS 1422058-54-5 appears in our catalog under these names: Pitavastatin Impurity 37, Pitavastatin Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
(5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxyhepta-3,6-dienoic acid (CAS 1422058-54-5) is a chemical compound with the molecular formula C25H22FNO3 and a molecular weight of 403.4 g/mol. IUPAC name: (5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxyhepta-3,6-dienoic acid. InChIKey: SUJDOIRGTCEPNA-LPCZIEJWSA-N.
| Molecular formula | C25H22FNO3 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | (5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxyhepta-3,6-dienoic acid |
| InChIKey | SUJDOIRGTCEPNA-LPCZIEJWSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2/C=C/[C@H](C=CCC(=O)O)O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)