CAS 1422144-42-0 appears in our catalog under these names: Ar-13324 mesylate, 95%, Netarsudil Dimesylate, AR-13324 mesylate, Netarsudil mesylate, AR–13324 mesylate. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 250mg, 100mg, on request, 25mg, 50mg, 10mg, 2mg, 5mg.
[4-[(2S)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate;methanesulfonic acid (CAS 1422144-42-0) is a chemical compound with the molecular formula C30H35N3O9S2 and a molecular weight of 645.7 g/mol. IUPAC name: [4-[(2S)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate;methanesulfonic acid. InChIKey: QQDRLKRHJOAQDC-FBHGDYMESA-N.
| Molecular formula | C30H35N3O9S2 |
|---|---|
| Molecular weight | 645.7 g/mol |
| IUPAC name | [4-[(2S)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate;methanesulfonic acid |
| InChIKey | QQDRLKRHJOAQDC-FBHGDYMESA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OCC2=CC=C(C=C2)[C@@H](CN)C(=O)NC3=CC4=C(C=C3)C=NC=C4)C.CS(=O)(=O)O.CS(=O)(=O)O |
Computed by PubChem (NCBI)