Products 1422251-09-9
CAS 1422251-09-9 is the registry number for SOMCL-668. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol (CAS 1422251-09-9) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: 3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol. InChIKey: YQRZJWYKYUBPKB-UHFFFAOYSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol |
| InChIKey | YQRZJWYKYUBPKB-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C=CC(=C2)O)C(C1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)