CAS 1422284-15-8 appears in our catalog under these names: Tenofovir Disoproxil USP Related Compound G Fumarate, Tenofovir Impurity F, Tenofovir disoproxil, Tenofovir Impurity 15. Offered by: Chemat Brand, Biosynth, Hubei YoungXin. Available pack sizes: on request, 1mg, 5mg, 10mg, 50mg, 25mg, 100mg, 200mg.
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-propan-2-yloxyphosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid (CAS 1422284-15-8) is a chemical compound with the molecular formula C21H32N5O11P and a molecular weight of 561.5 g/mol. IUPAC name: [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-propan-2-yloxyphosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid. InChIKey: KUKFSJJPWCVOBK-NOCXICHJSA-N.
| Molecular formula | C21H32N5O11P |
|---|---|
| Molecular weight | 561.5 g/mol |
| IUPAC name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-propan-2-yloxyphosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
| InChIKey | KUKFSJJPWCVOBK-NOCXICHJSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(OCOC(=O)OC(C)C)OC(C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)