CAS 1422284-17-0 appears in our catalog under these names: Tenofovir Disoproxil Impurity EOC-POCPMPA Fumarate, Tenofovir Impurity 7, DEC-POC PMPA, Tenofovir impurity 8 (fumarate). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(ethoxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid (CAS 1422284-17-0) is a chemical compound with the molecular formula C22H32N5O14P and a molecular weight of 621.5 g/mol. IUPAC name: [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(ethoxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid. InChIKey: RTAYHBFCHWFPSU-KRUTYQAESA-N.
| Molecular formula | C22H32N5O14P |
|---|---|
| Molecular weight | 621.5 g/mol |
| IUPAC name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(ethoxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
| InChIKey | RTAYHBFCHWFPSU-KRUTYQAESA-N |
| SMILES | CCOC(=O)OCOP(=O)(CO[C@H](C)CN1C=NC2=C(N=CN=C21)N)OCOC(=O)OC(C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)