CAS 1422344-30-6 is the registry number for tert-Butyl 3-(6-bromopyrazolo(1,5-a)pyridin-2-yl)azetidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl 3-(6-bromopyrazolo[1,5-a]pyridin-2-yl)azetidine-1-carboxylate (CAS 1422344-30-6) is a chemical compound with the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. IUPAC name: tert-butyl 3-(6-bromopyrazolo[1,5-a]pyridin-2-yl)azetidine-1-carboxylate. InChIKey: BFKYTNZIYRCLNM-UHFFFAOYSA-N.
| Molecular formula | C15H18BrN3O2 |
|---|---|
| Molecular weight | 352.23 g/mol |
| IUPAC name | tert-butyl 3-(6-bromopyrazolo[1,5-a]pyridin-2-yl)azetidine-1-carboxylate |
| InChIKey | BFKYTNZIYRCLNM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=NN3C=C(C=CC3=C2)Br |
Computed by PubChem (NCBI)