CAS 1422535-52-1 appears in our catalog under these names: T-3775440 hydrochloride/ 99.94% (existing batch purity), T–3775440 hydrochloride, T 3775440 hydrochloride, T-3775440 HCl 99%, T-3775440 hydrochloride, ≥99%, ≥99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
N-[4-[(1S,2R)-2-(cyclopropylmethylamino)cyclopropyl]phenyl]-1-methylpyrazole-4-carboxamide;hydrochloride (CAS 1422535-52-1) is a chemical compound with the molecular formula C18H23ClN4O and a molecular weight of 346.9 g/mol. IUPAC name: N-[4-[(1S,2R)-2-(cyclopropylmethylamino)cyclopropyl]phenyl]-1-methylpyrazole-4-carboxamide;hydrochloride. InChIKey: XYFPAGOQZFSLFH-MCJVGQIASA-N.
| Molecular formula | C18H23ClN4O |
|---|---|
| Molecular weight | 346.9 g/mol |
| IUPAC name | N-[4-[(1S,2R)-2-(cyclopropylmethylamino)cyclopropyl]phenyl]-1-methylpyrazole-4-carboxamide;hydrochloride |
| InChIKey | XYFPAGOQZFSLFH-MCJVGQIASA-N |
| SMILES | CN1C=C(C=N1)C(=O)NC2=CC=C(C=C2)[C@@H]3C[C@H]3NCC4CC4.Cl |
Computed by PubChem (NCBI)