CAS 1422540-81-5 appears in our catalog under these names: Propargyl–PEG4–5–nitrophenyl carbonate, Propargyl-PEG4-5-nitrophenyl carbonate, Propargyl-PEG4-5-nitrophenyl carbonate, 99+%, Propargyl-PEG4-5-nitrophenyl carbonate 95%, Propargyl-PEG4-5-nitrophenyl carbonate, 98.19%. Offered by: GLPBio, Biosynth, AmBeed, MedChemExpress, Combi-blocks. Available pack sizes: 100mg, 500mg, 1000mg, 5g, 50mg, 250mg, 1g, 25 mg.
(4-nitrophenyl) 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl carbonate (CAS 1422540-81-5) is a chemical compound with the molecular formula C18H23NO9 and a molecular weight of 397.4 g/mol. IUPAC name: (4-nitrophenyl) 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl carbonate. InChIKey: BRQWRLYCHVNDKS-UHFFFAOYSA-N.
| Molecular formula | C18H23NO9 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | (4-nitrophenyl) 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl carbonate |
| InChIKey | BRQWRLYCHVNDKS-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)