CAS 142266-62-4 appears in our catalog under these names: 2,5,6–Trichloronicotinamide, 2,5,6-Trichloronicotinamide 97%, 2,5,6-Trichloronicotinamide, 97%, 97%, 2,5,6-Trichloronicotinamide, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
2,5,6-trichloropyridine-3-carboxamide (CAS 142266-62-4) is a chemical compound with the molecular formula C6H3Cl3N2O and a molecular weight of 225.5 g/mol. IUPAC name: 2,5,6-trichloropyridine-3-carboxamide. InChIKey: DBAVDGXPOXFHRC-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3N2O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,5,6-trichloropyridine-3-carboxamide |
| InChIKey | DBAVDGXPOXFHRC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)