CAS 14227-87-3 appears in our catalog under these names: (2R,3S,4S,5R,6R)-2-(Acetoxymethyl)-6-chlorotetrahydro-2H-pyran-3,4,5-triyl triacetate, 97%, 2,3,4,6-Tetra-O-acetyl-Alpha-D-galactopyranosyl Chloride, 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl chloride, α-D-Galactopyranosyl chloride,2,3,4,6-tetraacetate. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5g, 25g, 2g, 1g, 5g, 10g, 1 g.
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-chlorooxan-2-yl]methyl acetate (CAS 14227-87-3) is a chemical compound with the molecular formula C14H19ClO9 and a molecular weight of 366.75 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-chlorooxan-2-yl]methyl acetate. InChIKey: BYWPSIUIJNAJDV-HTOAHKCRSA-N.
| Molecular formula | C14H19ClO9 |
|---|---|
| Molecular weight | 366.75 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-chlorooxan-2-yl]methyl acetate |
| InChIKey | BYWPSIUIJNAJDV-HTOAHKCRSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)Cl)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)