CAS 1422955-31-4 appears in our catalog under these names: N-(3-Chloro-5-fluorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine, TC-S 7009/ 100%, TC–S 7009, TC-S 7009 98%, TC-S 7009, 99.81%. Offered by: TRC, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 250mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1g.
N-(3-chloro-5-fluorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (CAS 1422955-31-4) is a chemical compound with the molecular formula C12H6ClFN4O3 and a molecular weight of 308.65 g/mol. IUPAC name: N-(3-chloro-5-fluorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine. InChIKey: CDQUJZKBRAFWNG-UHFFFAOYSA-N.
| Molecular formula | C12H6ClFN4O3 |
|---|---|
| Molecular weight | 308.65 g/mol |
| IUPAC name | N-(3-chloro-5-fluorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| InChIKey | CDQUJZKBRAFWNG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C(=C1NC3=CC(=CC(=C3)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)