CAS 1423-10-5 appears in our catalog under these names: Fluorobenzene-d5, Fluorobenzene-d5, 98 atom % D, min 98% Chemical Purity, Fluorobenzene–d5. Offered by: TRC, CDN, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1,2,3,4,5-pentadeuterio-6-fluorobenzene (CAS 1423-10-5) is a chemical compound with the molecular formula C6H5F and a molecular weight of 101.13 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-fluorobenzene. InChIKey: PYLWMHQQBFSUBP-RALIUCGRSA-N.
| Molecular formula | C6H5F |
|---|---|
| Molecular weight | 101.13 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-fluorobenzene |
| InChIKey | PYLWMHQQBFSUBP-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])F)[2H])[2H] |
Computed by PubChem (NCBI)