CAS 1423013-22-2 appears in our catalog under these names: Potassium trifluoro[1-(oxan-2-yl)pyrazol-4-yl]boranuide, 95%, Trifluoro(1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl)borate Potassium. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 2,5g.
Potassium trifluoro-[1-(oxan-2-yl)pyrazol-4-yl]boranuide (CAS 1423013-22-2) is a chemical compound with the molecular formula C8H11BF3KN2O and a molecular weight of 258.09 g/mol. IUPAC name: potassium trifluoro-[1-(oxan-2-yl)pyrazol-4-yl]boranuide. InChIKey: BFCBDXMNLWLVRE-UHFFFAOYSA-N.
| Molecular formula | C8H11BF3KN2O |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | potassium trifluoro-[1-(oxan-2-yl)pyrazol-4-yl]boranuide |
| InChIKey | BFCBDXMNLWLVRE-UHFFFAOYSA-N |
| SMILES | [B-](C1=CN(N=C1)C2CCCCO2)(F)(F)F.[K+] |
Computed by PubChem (NCBI)