CAS 1423015-65-9 appears in our catalog under these names: (1S)-1-(2-Methyl-1,3-thiazol-4-yl)ethan-1-amine dihydrochloride, 95%, (1S)-1-(2-Methyl-1,3-thiazol-4-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1S)-1-(2-methyl-1,3-thiazol-4-yl)ethanamine;dihydrochloride (CAS 1423015-65-9) is a chemical compound with the molecular formula C6H12Cl2N2S and a molecular weight of 215.14 g/mol. IUPAC name: (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethanamine;dihydrochloride. InChIKey: NSIYHWIWQYUIEN-FHNDMYTFSA-N.
| Molecular formula | C6H12Cl2N2S |
|---|---|
| Molecular weight | 215.14 g/mol |
| IUPAC name | (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethanamine;dihydrochloride |
| InChIKey | NSIYHWIWQYUIEN-FHNDMYTFSA-N |
| SMILES | CC1=NC(=CS1)[C@H](C)N.Cl.Cl |
Computed by PubChem (NCBI)