CAS 1423017-95-1 is the registry number for Pra-nh2 tfa, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-aminopent-4-ynoic acid;2,2,2-trifluoroacetic acid (CAS 1423017-95-1) is a chemical compound with the molecular formula C7H8F3NO4 and a molecular weight of 227.14 g/mol. IUPAC name: (2S)-2-aminopent-4-ynoic acid;2,2,2-trifluoroacetic acid. InChIKey: VITVOKLFILARSI-WCCKRBBISA-N.
| Molecular formula | C7H8F3NO4 |
|---|---|
| Molecular weight | 227.14 g/mol |
| IUPAC name | (2S)-2-aminopent-4-ynoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | VITVOKLFILARSI-WCCKRBBISA-N |
| SMILES | C#CC[C@@H](C(=O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)