Products 1423017-95-1

CAS 1423017-95-1 is the registry number for Pra-nh2 tfa, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

(2S)-2-aminopent-4-ynoic acid;2,2,2-trifluoroacetic acid (CAS 1423017-95-1) is a chemical compound with the molecular formula C7H8F3NO4 and a molecular weight of 227.14 g/mol. IUPAC name: (2S)-2-aminopent-4-ynoic acid;2,2,2-trifluoroacetic acid. InChIKey: VITVOKLFILARSI-WCCKRBBISA-N.

Identity
Molecular formulaC7H8F3NO4
Molecular weight227.14 g/mol
IUPAC name(2S)-2-aminopent-4-ynoic acid;2,2,2-trifluoroacetic acid
InChIKeyVITVOKLFILARSI-WCCKRBBISA-N
SMILESC#CC[C@@H](C(=O)O)N.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)