CAS 1423023-88-4 appears in our catalog under these names: 5-(Difluoromethyl)-1-(2-methylpropyl)-1H-pyrazol-4-amine hydrochloride, 95%, 5-(Difluoromethyl)-1-(2-methylpropyl)-1H-pyrazol-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(difluoromethyl)-1-(2-methylpropyl)pyrazol-4-amine;hydrochloride (CAS 1423023-88-4) is a chemical compound with the molecular formula C8H14ClF2N3 and a molecular weight of 225.67 g/mol. IUPAC name: 5-(difluoromethyl)-1-(2-methylpropyl)pyrazol-4-amine;hydrochloride. InChIKey: IKMOWIVRBGGVJL-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF2N3 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 5-(difluoromethyl)-1-(2-methylpropyl)pyrazol-4-amine;hydrochloride |
| InChIKey | IKMOWIVRBGGVJL-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=C(C=N1)N)C(F)F.Cl |
Computed by PubChem (NCBI)