CAS 1423024-25-2 appears in our catalog under these names: Sodium 2-(2,3-dihydro-1H-indol-1-yl)propanoate, 95%, Sodium 2-(2,3-dihydro-1H-indol-1-yl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Sodium 2-(2,3-dihydroindol-1-yl)propanoate (CAS 1423024-25-2) is a chemical compound with the molecular formula C11H12NNaO2 and a molecular weight of 213.21 g/mol. IUPAC name: sodium 2-(2,3-dihydroindol-1-yl)propanoate. InChIKey: IDXZMPROABRAOJ-UHFFFAOYSA-M.
| Molecular formula | C11H12NNaO2 |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | sodium 2-(2,3-dihydroindol-1-yl)propanoate |
| InChIKey | IDXZMPROABRAOJ-UHFFFAOYSA-M |
| SMILES | CC(C(=O)[O-])N1CCC2=CC=CC=C21.[Na+] |
Computed by PubChem (NCBI)