CAS 1423025-52-8 appears in our catalog under these names: N-(2-Aminoethyl)-2,5-dimethylthiophene-3-sulfonamide hydrochloride, 95%, N-(2-Aminoethyl)-2,5-dimethylthiophene-3-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride (CAS 1423025-52-8) is a chemical compound with the molecular formula C8H15ClN2O2S2 and a molecular weight of 270.8 g/mol. IUPAC name: N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride. InChIKey: LHMHQQWDRQYUDR-UHFFFAOYSA-N.
| Molecular formula | C8H15ClN2O2S2 |
|---|---|
| Molecular weight | 270.8 g/mol |
| IUPAC name | N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride |
| InChIKey | LHMHQQWDRQYUDR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)S(=O)(=O)NCCN.Cl |
Computed by PubChem (NCBI)