CAS 1423027-87-5 appears in our catalog under these names: 2-(4-Iodophenyl)pyrrolidine hydrochloride, 2-(4-Iodophenyl)pyrrolidine hydrochloride 95%, 2-(4-Iodophenyl)pyrrolidine hydrochloride, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
2-(4-iodophenyl)pyrrolidine;hydrochloride (CAS 1423027-87-5) is a chemical compound with the molecular formula C10H13ClIN and a molecular weight of 309.57 g/mol. IUPAC name: 2-(4-iodophenyl)pyrrolidine;hydrochloride. InChIKey: GMIBOSAPGGIPCF-UHFFFAOYSA-N.
| Molecular formula | C10H13ClIN |
|---|---|
| Molecular weight | 309.57 g/mol |
| IUPAC name | 2-(4-iodophenyl)pyrrolidine;hydrochloride |
| InChIKey | GMIBOSAPGGIPCF-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)I.Cl |
Computed by PubChem (NCBI)