CAS 1423030-11-8 appears in our catalog under these names: Olaparib Impurity 25, Olaparib Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-5-[(Z)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzoic acid (CAS 1423030-11-8) is a chemical compound with the molecular formula C16H9FO4 and a molecular weight of 284.24 g/mol. IUPAC name: 2-fluoro-5-[(Z)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzoic acid. InChIKey: FAZXGENUOIVDTH-ZSOIEALJSA-N.
| Molecular formula | C16H9FO4 |
|---|---|
| Molecular weight | 284.24 g/mol |
| IUPAC name | 2-fluoro-5-[(Z)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzoic acid |
| InChIKey | FAZXGENUOIVDTH-ZSOIEALJSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=CC(=C(C=C3)F)C(=O)O)/OC2=O |
Computed by PubChem (NCBI)