Products 1423032-41-0
CAS 1423032-41-0 is the registry number for 1-(2,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,4-dichlorophenyl)triazole-4-carbaldehyde (CAS 1423032-41-0) is a chemical compound with the molecular formula C9H5Cl2N3O and a molecular weight of 242.06 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)triazole-4-carbaldehyde. InChIKey: LCCOQKGOIDIVLG-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O |
|---|---|
| Molecular weight | 242.06 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)triazole-4-carbaldehyde |
| InChIKey | LCCOQKGOIDIVLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)N2C=C(N=N2)C=O |
Computed by PubChem (NCBI)