CAS 1423032-47-6 appears in our catalog under these names: 4-(Dimethylamino)-3,5-difluorobenzene-1-carboximidamide, 95%, 4-(Dimethylamino)-3,5-difluorobenzene-1-carboximidamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(dimethylamino)-3,5-difluorobenzenecarboximidamide (CAS 1423032-47-6) is a chemical compound with the molecular formula C9H11F2N3 and a molecular weight of 199.20 g/mol. IUPAC name: 4-(dimethylamino)-3,5-difluorobenzenecarboximidamide. InChIKey: FXMDKRZZJNKKNA-UHFFFAOYSA-N.
| Molecular formula | C9H11F2N3 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 4-(dimethylamino)-3,5-difluorobenzenecarboximidamide |
| InChIKey | FXMDKRZZJNKKNA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1F)C(=N)N)F |
Computed by PubChem (NCBI)