CAS 1423033-37-7 appears in our catalog under these names: 3-(Morpholin-2-yl)benzonitrile hydrochloride, 98%, 3-(Morpholin-2-yl)benzonitrile hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-morpholin-2-ylbenzonitrile;hydrochloride (CAS 1423033-37-7) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: 3-morpholin-2-ylbenzonitrile;hydrochloride. InChIKey: XDNTWVKXMLAEBD-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 3-morpholin-2-ylbenzonitrile;hydrochloride |
| InChIKey | XDNTWVKXMLAEBD-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC=CC(=C2)C#N.Cl |
Computed by PubChem (NCBI)