CAS 1423034-26-7 appears in our catalog under these names: 2-(4-Fluorobenzenesulfonamido)ethanimidamide hydrochloride, 95%, 2-(4-Fluorobenzenesulfonamido)ethanimidamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(4-fluorophenyl)sulfonylamino]ethanimidamide;hydrochloride (CAS 1423034-26-7) is a chemical compound with the molecular formula C8H11ClFN3O2S and a molecular weight of 267.71 g/mol. IUPAC name: 2-[(4-fluorophenyl)sulfonylamino]ethanimidamide;hydrochloride. InChIKey: CNRHPFNJCWIBNS-UHFFFAOYSA-N.
| Molecular formula | C8H11ClFN3O2S |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)sulfonylamino]ethanimidamide;hydrochloride |
| InChIKey | CNRHPFNJCWIBNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)NCC(=N)N.Cl |
Computed by PubChem (NCBI)