CAS 1423034-36-9 appears in our catalog under these names: 4-(Cyclopentylsulfanyl)aniline hydrochloride, 95%, 4-(Cyclopentylsulfanyl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-cyclopentylsulfanylaniline;hydrochloride (CAS 1423034-36-9) is a chemical compound with the molecular formula C11H16ClNS and a molecular weight of 229.77 g/mol. IUPAC name: 4-cyclopentylsulfanylaniline;hydrochloride. InChIKey: IZRBHBWGYGHVKM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNS |
|---|---|
| Molecular weight | 229.77 g/mol |
| IUPAC name | 4-cyclopentylsulfanylaniline;hydrochloride |
| InChIKey | IZRBHBWGYGHVKM-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)SC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)