Products 1423034-53-0

CAS 1423034-53-0 is the registry number for 7-(7-Aminoheptanamido)heptanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

7-(7-aminoheptanoylamino)heptanoic acid;hydrochloride (CAS 1423034-53-0) is a chemical compound with the molecular formula C14H29ClN2O3 and a molecular weight of 308.84 g/mol. IUPAC name: 7-(7-aminoheptanoylamino)heptanoic acid;hydrochloride. InChIKey: OWVBGHPTFAZJLB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H29ClN2O3
Molecular weight308.84 g/mol
IUPAC name7-(7-aminoheptanoylamino)heptanoic acid;hydrochloride
InChIKeyOWVBGHPTFAZJLB-UHFFFAOYSA-N
SMILESC(CCCN)CCC(=O)NCCCCCCC(=O)O.Cl

Computed by PubChem (NCBI)