CAS 1423034-71-2 appears in our catalog under these names: Methyl 2-(4-(aminomethyl)-3,5-dimethyl-1H-pyrazol-1-yl)acetate dihydrochloride, 95%, Methyl 2-(4-(aminomethyl)-3,5-dimethyl-1H-pyrazol-1-yl)acetate dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 2-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]acetate;dihydrochloride (CAS 1423034-71-2) is a chemical compound with the molecular formula C9H17Cl2N3O2 and a molecular weight of 270.15 g/mol. IUPAC name: methyl 2-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]acetate;dihydrochloride. InChIKey: HAWDSTJTISLILR-UHFFFAOYSA-N.
| Molecular formula | C9H17Cl2N3O2 |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | methyl 2-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]acetate;dihydrochloride |
| InChIKey | HAWDSTJTISLILR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(=O)OC)C)CN.Cl.Cl |
Computed by PubChem (NCBI)