CAS 1423040-69-0 appears in our catalog under these names: (5R)-2,3,4,5-Tetrahydro-1-benzoxepin-5-ol, 95%, (5R)-2,3,4,5-Tetrahydro-1-benzoxepin-5-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(5R)-2,3,4,5-tetrahydro-1-benzoxepin-5-ol (CAS 1423040-69-0) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (5R)-2,3,4,5-tetrahydro-1-benzoxepin-5-ol. InChIKey: OJZWTYXMABCBFG-SECBINFHSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (5R)-2,3,4,5-tetrahydro-1-benzoxepin-5-ol |
| InChIKey | OJZWTYXMABCBFG-SECBINFHSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2OC1)O |
Computed by PubChem (NCBI)