CAS 1423126-69-5 is the registry number for YLL545. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (CAS 1423126-69-5) is a chemical compound with the molecular formula C19H13F3N6O2 and a molecular weight of 414.3 g/mol. IUPAC name: 1-[4-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: RSRQFBNVFQZQRN-UHFFFAOYSA-N.
| Molecular formula | C19H13F3N6O2 |
|---|---|
| Molecular weight | 414.3 g/mol |
| IUPAC name | 1-[4-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | RSRQFBNVFQZQRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)NC2=CC=C(C=C2)OC3=NC=NC4=C3C=NN4)C(F)(F)F |
Computed by PubChem (NCBI)