CAS 1423161-84-5 appears in our catalog under these names: 3-Bromo-1-methyl-1h-indole-6-sulfonyl chloride, 95%, 3-Bromo-1-methyl-1H-indole-6-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 50mg, 0,5g.
3-bromo-1-methylindole-6-sulfonyl chloride (CAS 1423161-84-5) is a chemical compound with the molecular formula C9H7BrClNO2S and a molecular weight of 308.58 g/mol. IUPAC name: 3-bromo-1-methylindole-6-sulfonyl chloride. InChIKey: TUFMAZRBDPPFDG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO2S |
|---|---|
| Molecular weight | 308.58 g/mol |
| IUPAC name | 3-bromo-1-methylindole-6-sulfonyl chloride |
| InChIKey | TUFMAZRBDPPFDG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=C(C=C2)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)