CAS 14233-64-8 appears in our catalog under these names: 2,3,5-Tri-o-benzyl-d-arabino-1,4-lactone, 95%, 2,3,5–tri–O–benzyl–D–arabino–γ–lactone, 2,3,5-Tri-O-benzyl-D-arabino-1,4-lactone. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 2g, 5g, 25g, 10g.
(3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one (CAS 14233-64-8) is a chemical compound with the molecular formula C26H26O5 and a molecular weight of 418.5 g/mol. IUPAC name: (3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one. InChIKey: LDHBSABBBAUMCZ-SDHSZQHLSA-N.
| Molecular formula | C26H26O5 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | (3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one |
| InChIKey | LDHBSABBBAUMCZ-SDHSZQHLSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@H]([C@@H](C(=O)O2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)