CAS 142356-62-5 appears in our catalog under these names: 5,6–Difluoro–1H–1,3–benzodiazol–2–amine, 5,6-Difluoro-1H-1,3-benzodiazol-2-amine, 5,6-Difluoro-1H-1,3-benzodiazol-2-amine 95%, 5,6-Difluoro-1H-1,3-benzodiazol-2-amine, 95%, 95%, 5,6-Difluoro-1H-1,3-benzodiazol-2-amine, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
5,6-difluoro-1H-benzimidazol-2-amine (CAS 142356-62-5) is a chemical compound with the molecular formula C7H5F2N3 and a molecular weight of 169.13 g/mol. IUPAC name: 5,6-difluoro-1H-benzimidazol-2-amine. InChIKey: ARMZWEKTPLCJKD-UHFFFAOYSA-N.
| Molecular formula | C7H5F2N3 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5,6-difluoro-1H-benzimidazol-2-amine |
| InChIKey | ARMZWEKTPLCJKD-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)N=C(N2)N |
Computed by PubChem (NCBI)