CAS 14239-68-0 appears in our catalog under these names: Cadmium diethyldithiocarbamate, 95%, Cadmium diethyldithiocarbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2000mg, 1000mg, 5000mg, 10000mg.
Cadmium(2+);bis(N,N-diethylcarbamodithioate) (CAS 14239-68-0) is a chemical compound with the molecular formula C10H20CdN2S4 and a molecular weight of 409.0 g/mol. IUPAC name: cadmium(2+);bis(N,N-diethylcarbamodithioate). InChIKey: QQOALHQRKUYNIC-UHFFFAOYSA-L.
| Molecular formula | C10H20CdN2S4 |
|---|---|
| Molecular weight | 409.0 g/mol |
| IUPAC name | cadmium(2+);bis(N,N-diethylcarbamodithioate) |
| InChIKey | QQOALHQRKUYNIC-UHFFFAOYSA-L |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Cd+2] |
Computed by PubChem (NCBI)