Products 1424334-61-1
CAS 1424334-61-1 is the registry number for 3-((1,3-Dimethyl-4-nitro-1H-pyrazol-5-yl)amino)propane-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]propane-1,2-diol (CAS 1424334-61-1) is a chemical compound with the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. IUPAC name: 3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]propane-1,2-diol. InChIKey: LRTKTULKGVYGRA-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]propane-1,2-diol |
| InChIKey | LRTKTULKGVYGRA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])NCC(CO)O)C |
Computed by PubChem (NCBI)