CAS 1424353-63-8 is the registry number for PNR-3-80. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 10 mg, 100 mg.
5-[[5-chloro-1-(naphthalene-2-carbonyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 1424353-63-8) is a chemical compound with the molecular formula C24H14ClN3O3S and a molecular weight of 459.9 g/mol. IUPAC name: 5-[[5-chloro-1-(naphthalene-2-carbonyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: KCCZTAHJFROOTO-UHFFFAOYSA-N.
| Molecular formula | C24H14ClN3O3S |
|---|---|
| Molecular weight | 459.9 g/mol |
| IUPAC name | 5-[[5-chloro-1-(naphthalene-2-carbonyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | KCCZTAHJFROOTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)N3C=C(C4=C3C=CC(=C4)Cl)C=C5C(=O)NC(=S)NC5=O |
Computed by PubChem (NCBI)