CAS 142439-61-0 is the registry number for SN23862. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[bis(2-chloroethyl)amino]-2,4-dinitrobenzamide (CAS 142439-61-0) is a chemical compound with the molecular formula C11H12Cl2N4O5 and a molecular weight of 351.14 g/mol. IUPAC name: 5-[bis(2-chloroethyl)amino]-2,4-dinitrobenzamide. InChIKey: DQMALWRRERBILB-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N4O5 |
|---|---|
| Molecular weight | 351.14 g/mol |
| IUPAC name | 5-[bis(2-chloroethyl)amino]-2,4-dinitrobenzamide |
| InChIKey | DQMALWRRERBILB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N(CCCl)CCCl)[N+](=O)[O-])[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)