CAS 142439-94-9 appears in our catalog under these names: Rp-cAMPS sodium/ 99.71% (existing batch purity), Rp–cAMPS sodium salt, Rp-cAMPS (sodium salt), Rp-cAMPS (sodium salt), 99.69%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mM/1mL, 25 mg, 50 mg, 5 mg, 100 mg, 10 mg.
Sodium (4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-oxido-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (CAS 142439-94-9) is a chemical compound with the molecular formula C10H11N5NaO5PS and a molecular weight of 367.26 g/mol. IUPAC name: sodium (4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-oxido-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol. InChIKey: YTUKZYORDGLGPR-NVGWRVNNSA-M.
| Molecular formula | C10H11N5NaO5PS |
|---|---|
| Molecular weight | 367.26 g/mol |
| IUPAC name | sodium (4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-oxido-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| InChIKey | YTUKZYORDGLGPR-NVGWRVNNSA-M |
| SMILES | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=S)(O1)[O-].[Na+] |
Computed by PubChem (NCBI)