Products 1424394-95-5
CAS 1424394-95-5 is the registry number for 3-tert-Butyl-5-methyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylic acid (CAS 1424394-95-5) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylic acid. InChIKey: UYNJMTNUXYKTJJ-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 3-tert-butyl-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
| InChIKey | UYNJMTNUXYKTJJ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=NO1)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)