CAS 1424438-54-9 appears in our catalog under these names: 6-Chloro-4-N-(dicyclopropylmethyl)-4-N-methylpyrimidine-2,4-diamine, 95%, 6-Chloro-4-N-(dicyclopropylmethyl)-4-N-methylpyrimidine-2,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-chloro-4-N-(dicyclopropylmethyl)-4-N-methylpyrimidine-2,4-diamine (CAS 1424438-54-9) is a chemical compound with the molecular formula C12H17ClN4 and a molecular weight of 252.74 g/mol. IUPAC name: 6-chloro-4-N-(dicyclopropylmethyl)-4-N-methylpyrimidine-2,4-diamine. InChIKey: RGGNAYPPEMEZHQ-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN4 |
|---|---|
| Molecular weight | 252.74 g/mol |
| IUPAC name | 6-chloro-4-N-(dicyclopropylmethyl)-4-N-methylpyrimidine-2,4-diamine |
| InChIKey | RGGNAYPPEMEZHQ-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=NC(=N1)N)Cl)C(C2CC2)C3CC3 |
Computed by PubChem (NCBI)