CAS 142465-09-6 is the registry number for 3,5-Diphenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3,5-diphenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 142465-09-6) is a chemical compound with the molecular formula C18H12N2OS2 and a molecular weight of 336.4 g/mol. IUPAC name: 3,5-diphenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: JWFKCKHXCWRVDN-UHFFFAOYSA-N.
| Molecular formula | C18H12N2OS2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 3,5-diphenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | JWFKCKHXCWRVDN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2C(=O)N(C(=S)N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)