CAS 1424939-55-8 is the registry number for N-(4,5,6-Trimethylpyrimidin-2-yl)thiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4,5,6-trimethylpyrimidin-2-yl)thiourea (CAS 1424939-55-8) is a chemical compound with the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. IUPAC name: (4,5,6-trimethylpyrimidin-2-yl)thiourea. InChIKey: LODBGIQYHAHDOL-UHFFFAOYSA-N.
| Molecular formula | C8H12N4S |
|---|---|
| Molecular weight | 196.28 g/mol |
| IUPAC name | (4,5,6-trimethylpyrimidin-2-yl)thiourea |
| InChIKey | LODBGIQYHAHDOL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1C)NC(=S)N)C |
Computed by PubChem (NCBI)